C19H21FN4O4S — CID 8871416
2-[4-[(Z)-[(4-fluorophenyl)methylcarbamothioylhydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide (PubChem CID 8871416) has the molecular formula C19H21FN4O4S and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4-fluorophenyl)methylcarbamothioylhydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[(4-fluorophenyl)methylcarbamothioylhydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 8871416 |
| Molecular Formula | C19H21FN4O4S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[4-[(Z)-[(4-fluorophenyl)methylcarbamothioylhydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=N\NC(=S)NCc2ccc(F)cc2)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C19H21FN4O4S/c1-26-15-7-13(8-16(27-2)18(15)28-11-17(21)25)10-23-24-19(29)22-9-12-3-5-14(20)6-4-12/h3-8,10H,9,11H2,1-2H3,(H2,21,25)(H2,22,24,29)/b23-10- |
| InChIKey | XCTKOHRCJYQTEN-RMORIDSASA-N |
| XLogP | 1.71 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|