C17H17F2N3O4 — CID 8825944
2-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide (PubChem CID 8825944) has the molecular formula C17H17F2N3O4 and a molecular weight of 365.34 g/mol. Its IUPAC name is 2-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 8825944 |
| Molecular Formula | C17H17F2N3O4 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=N\Nc2ccc(F)cc2F)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C17H17F2N3O4/c1-24-14-5-10(6-15(25-2)17(14)26-9-16(20)23)8-21-22-13-4-3-11(18)7-12(13)19/h3-8,22H,9H2,1-2H3,(H2,20,23)/b21-8- |
| InChIKey | QNKGCLUCEJIIRZ-WNFQYIGGSA-N |
| XLogP | 2.29 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|