About 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline
2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline (PubChem CID 164513023) has the molecular formula C16H17FN2O3
and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline.
Molecular Properties
| Compound Name | 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline |
| PubChem CID | 164513023 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=N/NC2=CC=CC=C2F |
| InChI | InChI=1S/C16H17FN2O3/c1-20-14-8-11(9-15(21-2)16(14)22-3)10-18-19-13-7-5-4-6-12(13)17/h4-10,19H,1-3H3/b18-10+ |
| InChIKey | NHCIEVAQGNCKCN-VCHYOVAHSA-N |
| XLogP | 3.60 |
| TPSA | 52.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | 342 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline?
The IUPAC name of 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline (CID 164513023) is 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline.
What is the SMILES notation for 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline?
The canonical SMILES for 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline is COC1=CC(=CC(=C1OC)OC)/C=N/NC2=CC=CC=C2F.
What is the InChIKey of 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline?
The InChIKey is NHCIEVAQGNCKCN-VCHYOVAHSA-N. The full InChI is InChI=1S/C16H17FN2O3/c1-20-14-8-11(9-15(21-2)16(14)22-3)10-18-19-13-7-5-4-6-12(13)17/h4-10,19H,1-3H3/b18-10+.
What are the key properties of 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline?
2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline has a molecular weight of 304.32 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline is sourced from PubChem (CID 164513023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).