C15H15FN2O3 — CID 135858157
4-[(E)-[(2-fluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol (PubChem CID 135858157) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-[(E)-[(2-fluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(E)-[(2-fluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 135858157 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[(E)-[(2-fluorophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(/C=N/Nc2ccccc2F)cc(OC)c1O |
| InChI | InChI=1S/C15H15FN2O3/c1-20-13-7-10(8-14(21-2)15(13)19)9-17-18-12-6-4-3-5-11(12)16/h3-9,18-19H,1-2H3/b17-9+ |
| InChIKey | SMUVDFGLQJWVRC-RQZCQDPDSA-N |
| XLogP | 2.99 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|