C15H12ClF2N3O4 — CID 9059090
N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-nitroaniline (PubChem CID 9059090) has the molecular formula C15H12ClF2N3O4 and a molecular weight of 371.73 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-nitroaniline.
| Compound Name | N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-nitroaniline |
|---|---|
| PubChem CID | 9059090 |
| Molecular Formula | C15H12ClF2N3O4 |
| Molecular Weight | 371.73 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-nitroaniline |
| SMILES | COc1cc(/C=N\Nc2ccccc2[N+](=O)[O-])cc(Cl)c1OC(F)F |
| InChI | InChI=1S/C15H12ClF2N3O4/c1-24-13-7-9(6-10(16)14(13)25-15(17)18)8-19-20-11-4-2-3-5-12(11)21(22)23/h2-8,15,20H,1H3/b19-8- |
| InChIKey | SMKJKKHFVBWZTC-UWVJOHFNSA-N |
| XLogP | 4.30 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.73 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|