C17H14ClF2N2O5- — CID 8974239
4-chloro-3-[(2Z)-2-[[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylidene]hydrazinyl]benzoate (PubChem CID 8974239) has the molecular formula C17H14ClF2N2O5- and a molecular weight of 399.76 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 4-chloro-3-[(2Z)-2-[[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 8974239 |
| Molecular Formula | C17H14ClF2N2O5- |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylidene]hydrazinyl]benzoate |
| SMILES | COc1cc(/C=N\Nc2cc(C(=O)[O-])ccc2Cl)cc(OC)c1OC(F)F |
| InChI | InChI=1S/C17H15ClF2N2O5/c1-25-13-5-9(6-14(26-2)15(13)27-17(19)20)8-21-22-12-7-10(16(23)24)3-4-11(12)18/h3-8,17,22H,1-2H3,(H,23,24)/p-1/b21-8- |
| InChIKey | VKGQKWBYCBPLOS-WNFQYIGGSA-M |
| XLogP | 2.77 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|