C18H14ClN2O4- — CID 9012927
4-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]benzoate (PubChem CID 9012927) has the molecular formula C18H14ClN2O4- and a molecular weight of 357.77 g/mol. Its IUPAC name is 4-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 9012927 |
| Molecular Formula | C18H14ClN2O4- |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]benzoate |
| SMILES | C#CCOc1c(Cl)cc(/C=N\Nc2ccc(C(=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C18H15ClN2O4/c1-3-8-25-17-15(19)9-12(10-16(17)24-2)11-20-21-14-6-4-13(5-7-14)18(22)23/h1,4-7,9-11,21H,8H2,2H3,(H,22,23)/p-1/b20-11- |
| InChIKey | HSHAOJUJIBDJNK-JAIQZWGSSA-M |
| XLogP | 2.17 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|