C16H15ClN2O4 — CID 84901065
4-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 84901065) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is 4-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 84901065 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | COc1cc(C=NNc2ccc(C(=O)O)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C16H15ClN2O4/c1-22-14-8-10(7-13(17)15(14)23-2)9-18-19-12-5-3-11(4-6-12)16(20)21/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | IDGMKFJOGYBIGT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|