C16H13Cl2N2O4- — CID 7323628
2-chloro-5-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoate (PubChem CID 7323628) has the molecular formula C16H13Cl2N2O4- and a molecular weight of 368.20 g/mol. Its IUPAC name is 2-chloro-5-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoate.
| Compound Name | 2-chloro-5-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7323628 |
| Molecular Formula | C16H13Cl2N2O4- |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2-chloro-5-[2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]hydrazinyl]benzoate |
| SMILES | COc1cc(C=NNc2ccc(Cl)c(C(=O)[O-])c2)cc(Cl)c1OC |
| InChI | InChI=1S/C16H14Cl2N2O4/c1-23-14-6-9(5-13(18)15(14)24-2)8-19-20-10-3-4-12(17)11(7-10)16(21)22/h3-8,20H,1-2H3,(H,21,22)/p-1 |
| InChIKey | XQBBTYCKDXTERC-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|