C16H14ClN2O4- — CID 7416481
2-chloro-5-[(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoate (PubChem CID 7416481) has the molecular formula C16H14ClN2O4- and a molecular weight of 333.75 g/mol. Its IUPAC name is 2-chloro-5-[(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoate.
| Compound Name | 2-chloro-5-[(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7416481 |
| Molecular Formula | C16H14ClN2O4- |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-chloro-5-[(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoate |
| SMILES | COc1cccc(/C=N\Nc2ccc(Cl)c(C(=O)[O-])c2)c1OC |
| InChI | InChI=1S/C16H15ClN2O4/c1-22-14-5-3-4-10(15(14)23-2)9-18-19-11-6-7-13(17)12(8-11)16(20)21/h3-9,19H,1-2H3,(H,20,21)/p-1/b18-9- |
| InChIKey | RORUDSVPDXWBQL-NVMNQCDNSA-M |
| XLogP | 2.17 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|