C17H17N2O5- — CID 7066821
3-[(2Z)-2-[(2,3,4-trimethoxyphenyl)methylidene]hydrazinyl]benzoate (PubChem CID 7066821) has the molecular formula C17H17N2O5- and a molecular weight of 329.33 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2,3,4-trimethoxyphenyl)methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2Z)-2-[(2,3,4-trimethoxyphenyl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7066821 |
| Molecular Formula | C17H17N2O5- |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-[(2Z)-2-[(2,3,4-trimethoxyphenyl)methylidene]hydrazinyl]benzoate |
| SMILES | COc1ccc(/C=N\Nc2cccc(C(=O)[O-])c2)c(OC)c1OC |
| InChI | InChI=1S/C17H18N2O5/c1-22-14-8-7-12(15(23-2)16(14)24-3)10-18-19-13-6-4-5-11(9-13)17(20)21/h4-10,19H,1-3H3,(H,20,21)/p-1/b18-10- |
| InChIKey | ZIJIELBBULCVKU-ZDLGFXPLSA-M |
| XLogP | 1.52 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|