C16H13F5N2O3 — CID 9466478
2,3,4,5,6-pentafluoro-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]aniline (PubChem CID 9466478) has the molecular formula C16H13F5N2O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 9466478 |
| Molecular Formula | C16H13F5N2O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]aniline |
| SMILES | COc1ccc(/C=N\Nc2c(F)c(F)c(F)c(F)c2F)c(OC)c1OC |
| InChI | InChI=1S/C16H13F5N2O3/c1-24-8-5-4-7(15(25-2)16(8)26-3)6-22-23-14-12(20)10(18)9(17)11(19)13(14)21/h4-6,23H,1-3H3/b22-6- |
| InChIKey | BQRMOUXZNICHFP-HCDFXORVSA-N |
| XLogP | 3.85 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|