C21H29N7O3 — CID 4003031
4,6-dipyrrolidin-1-yl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine (PubChem CID 4003031) has the molecular formula C21H29N7O3 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4,6-dipyrrolidin-1-yl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dipyrrolidin-1-yl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4003031 |
| Molecular Formula | C21H29N7O3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 4,6-dipyrrolidin-1-yl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(C=NNc2nc(N3CCCC3)nc(N3CCCC3)n2)c(OC)c1OC |
| InChI | InChI=1S/C21H29N7O3/c1-29-16-9-8-15(17(30-2)18(16)31-3)14-22-26-19-23-20(27-10-4-5-11-27)25-21(24-19)28-12-6-7-13-28/h8-9,14H,4-7,10-13H2,1-3H3,(H,23,24,25,26) |
| InChIKey | FOBSCGHEQXEELX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|