C22H31N7O2 — CID 136744794
4-[(Z)-[[4,6-bis(azepan-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 136744794) has the molecular formula C22H31N7O2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-[(Z)-[[4,6-bis(azepan-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | 4-[(Z)-[[4,6-bis(azepan-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136744794 |
| Molecular Formula | C22H31N7O2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 4-[(Z)-[[4,6-bis(azepan-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N\Nc2nc(N3CCCCCC3)nc(N3CCCCCC3)n2)c(O)c1 |
| InChI | InChI=1S/C22H31N7O2/c30-18-10-9-17(19(31)15-18)16-23-27-20-24-21(28-11-5-1-2-6-12-28)26-22(25-20)29-13-7-3-4-8-14-29/h9-10,15-16,30-31H,1-8,11-14H2,(H,24,25,26,27)/b23-16- |
| InChIKey | CKIOJDUWQFQBBL-KQWNVCNZSA-N |
| XLogP | 3.49 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|