C25H32N8O — CID 137172606
2-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-5-(diethylamino)phenol (PubChem CID 137172606) has the molecular formula C25H32N8O and a molecular weight of 460.59 g/mol. Its IUPAC name is 2-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-5-(diethylamino)phenol.
| Compound Name | 2-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 137172606 |
| Molecular Formula | C25H32N8O |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 2-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(/C=N\Nc2nc(Nc3ccccc3)nc(N3CCCCC3)n2)c(O)c1 |
| InChI | InChI=1S/C25H32N8O/c1-3-32(4-2)21-14-13-19(22(34)17-21)18-26-31-24-28-23(27-20-11-7-5-8-12-20)29-25(30-24)33-15-9-6-10-16-33/h5,7-8,11-14,17-18,34H,3-4,6,9-10,15-16H2,1-2H3,(H2,27,28,29,30,31)/b26-18- |
| InChIKey | DVXKBZYGQXPLKK-ITYLOYPMSA-N |
| XLogP | 4.60 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|