C23H25Br2N7O2 — CID 4224176
2-[[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-3,4-dibromo-6-ethoxyphenol (PubChem CID 4224176) has the molecular formula C23H25Br2N7O2 and a molecular weight of 591.31 g/mol. Its IUPAC name is 2-[[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-3,4-dibromo-6-ethoxyphenol.
| Compound Name | 2-[[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-3,4-dibromo-6-ethoxyphenol |
|---|---|
| PubChem CID | 4224176 |
| Molecular Formula | C23H25Br2N7O2 |
| Molecular Weight | 591.31 g/mol |
| Exact Mass | 589.04 |
| IUPAC Name | 2-[[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-3,4-dibromo-6-ethoxyphenol |
| SMILES | CCOc1cc(Br)c(Br)c(C=NNc2nc(Nc3ccccc3)nc(N3CCCCC3)n2)c1O |
| InChI | InChI=1S/C23H25Br2N7O2/c1-2-34-18-13-17(24)19(25)16(20(18)33)14-26-31-22-28-21(27-15-9-5-3-6-10-15)29-23(30-22)32-11-7-4-8-12-32/h3,5-6,9-10,13-14,33H,2,4,7-8,11-12H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | CITDFDZTJHKXCC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.31 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|