C20H22N8 — CID 5071726
4-N-phenyl-6-piperidin-1-yl-2-N-(pyridin-4-ylmethylideneamino)-1,3,5-triazine-2,4-diamine (PubChem CID 5071726) has the molecular formula C20H22N8 and a molecular weight of 374.45 g/mol. Its IUPAC name is 4-N-phenyl-6-piperidin-1-yl-2-N-(pyridin-4-ylmethylideneamino)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-phenyl-6-piperidin-1-yl-2-N-(pyridin-4-ylmethylideneamino)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 5071726 |
| Molecular Formula | C20H22N8 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-N-phenyl-6-piperidin-1-yl-2-N-(pyridin-4-ylmethylideneamino)-1,3,5-triazine-2,4-diamine |
| SMILES | C(=NNc1nc(Nc2ccccc2)nc(N2CCCCC2)n1)c1ccncc1 |
| InChI | InChI=1S/C20H22N8/c1-3-7-17(8-4-1)23-18-24-19(27-22-15-16-9-11-21-12-10-16)26-20(25-18)28-13-5-2-6-14-28/h1,3-4,7-12,15H,2,5-6,13-14H2,(H2,23,24,25,26,27) |
| InChIKey | OMYLXIJAQBARMC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|