C20H20IN7 — CID 85026567
2-N-[(3-iodophenyl)methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 85026567) has the molecular formula C20H20IN7 and a molecular weight of 485.33 g/mol. Its IUPAC name is 2-N-[(3-iodophenyl)methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(3-iodophenyl)methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 85026567 |
| Molecular Formula | C20H20IN7 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-N-[(3-iodophenyl)methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Ic1cccc(C=NNc2nc(Nc3ccccc3)nc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C20H20IN7/c21-16-8-6-7-15(13-16)14-22-27-19-24-18(23-17-9-2-1-3-10-17)25-20(26-19)28-11-4-5-12-28/h1-3,6-10,13-14H,4-5,11-12H2,(H2,23,24,25,26,27) |
| InChIKey | HJHJOWUFJHWVED-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|