C27H26FN7O — CID 50870677
2-N-[(E)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 50870677) has the molecular formula C27H26FN7O and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-N-[(E)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 50870677 |
| Molecular Formula | C27H26FN7O |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-N-[(E)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1ccc(COc2cccc(/C=N/Nc3nc(Nc4ccccc4)nc(N4CCCC4)n3)c2)cc1 |
| InChI | InChI=1S/C27H26FN7O/c28-22-13-11-20(12-14-22)19-36-24-10-6-7-21(17-24)18-29-34-26-31-25(30-23-8-2-1-3-9-23)32-27(33-26)35-15-4-5-16-35/h1-3,6-14,17-18H,4-5,15-16,19H2,(H2,30,31,32,33,34)/b29-18+ |
| InChIKey | YLCMKRUJDNOOSY-RDRPBHBLSA-N |
| XLogP | 5.38 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|