C22H23N7O3 — CID 4022763
2-[3-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 4022763) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[3-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 4022763 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[3-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C=NNc2nc(Nc3ccccc3)nc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C22H23N7O3/c30-19(31)15-32-18-10-6-7-16(13-18)14-23-28-21-25-20(24-17-8-2-1-3-9-17)26-22(27-21)29-11-4-5-12-29/h1-3,6-10,13-14H,4-5,11-12,15H2,(H,30,31)(H2,24,25,26,27,28) |
| InChIKey | OJCSQXHLHADRFW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|