C22H22BrN7O2 — CID 6172842
2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 6172842) has the molecular formula C22H22BrN7O2 and a molecular weight of 496.37 g/mol. Its IUPAC name is 2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6172842 |
| Molecular Formula | C22H22BrN7O2 |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Brc1cc2c(cc1/C=N\Nc1nc(Nc3ccccc3)nc(N3CCCCC3)n1)OCO2 |
| InChI | InChI=1S/C22H22BrN7O2/c23-17-12-19-18(31-14-32-19)11-15(17)13-24-29-21-26-20(25-16-7-3-1-4-8-16)27-22(28-21)30-9-5-2-6-10-30/h1,3-4,7-8,11-13H,2,5-6,9-10,14H2,(H2,25,26,27,28,29)/b24-13- |
| InChIKey | JCINYGAVSMFXNV-CFRMEGHHSA-N |
| XLogP | 4.54 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|