C26H26BrN7O — CID 50870597
2-N-[(E)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 50870597) has the molecular formula C26H26BrN7O and a molecular weight of 532.45 g/mol. Its IUPAC name is 2-N-[(E)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 50870597 |
| Molecular Formula | C26H26BrN7O |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 2-N-[(E)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2ccc(/C=N/Nc3nc(Nc4ccccc4)nc(N4CCCCC4)n3)o2)c(Br)c1 |
| InChI | InChI=1S/C26H26BrN7O/c1-18-10-12-21(22(27)16-18)23-13-11-20(35-23)17-28-33-25-30-24(29-19-8-4-2-5-9-19)31-26(32-25)34-14-6-3-7-15-34/h2,4-5,8-13,16-17H,3,6-7,14-15H2,1H3,(H2,29,30,31,32,33)/b28-17+ |
| InChIKey | LCINSYOAPHIFMJ-OGLMXYFKSA-N |
| XLogP | 6.38 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|