C25H27N7 — CID 172964043
2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 172964043) has the molecular formula C25H27N7 and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 172964043 |
| Molecular Formula | C25H27N7 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N/N=C/C3=CCc4ccccc43)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C25H27N7/c1-18-9-13-21(14-10-18)27-23-28-24(30-25(29-23)32-15-5-2-6-16-32)31-26-17-20-12-11-19-7-3-4-8-22(19)20/h3-4,7-10,12-14,17H,2,5-6,11,15-16H2,1H3,(H2,27,28,29,30,31)/b26-17+ |
| InChIKey | HUHBEJSIFXSPKG-YZSQISJMSA-N |
| XLogP | 4.95 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|