C25H24BrN7O — CID 94845058
2-N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 94845058) has the molecular formula C25H24BrN7O and a molecular weight of 518.42 g/mol. Its IUPAC name is 2-N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 94845058 |
| Molecular Formula | C25H24BrN7O |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 2-N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2ccc(/C=N\Nc3nc(Nc4ccccc4)nc(N4CCCC4)n3)o2)c(Br)c1 |
| InChI | InChI=1S/C25H24BrN7O/c1-17-9-11-20(21(26)15-17)22-12-10-19(34-22)16-27-32-24-29-23(28-18-7-3-2-4-8-18)30-25(31-24)33-13-5-6-14-33/h2-4,7-12,15-16H,5-6,13-14H2,1H3,(H2,28,29,30,31,32)/b27-16- |
| InChIKey | WVUDUBHZUVOULJ-YUMHPJSZSA-N |
| XLogP | 5.99 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|