C24H21Cl2N7O2 — CID 6242628
2-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 6242628) has the molecular formula C24H21Cl2N7O2 and a molecular weight of 510.39 g/mol. Its IUPAC name is 2-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6242628 |
| Molecular Formula | C24H21Cl2N7O2 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 2-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1cccc(-c2ccc(/C=N\Nc3nc(Nc4ccccc4)nc(N4CCOCC4)n3)o2)c1Cl |
| InChI | InChI=1S/C24H21Cl2N7O2/c25-19-8-4-7-18(21(19)26)20-10-9-17(35-20)15-27-32-23-29-22(28-16-5-2-1-3-6-16)30-24(31-23)33-11-13-34-14-12-33/h1-10,15H,11-14H2,(H2,28,29,30,31,32)/b27-15- |
| InChIKey | CYNOZCXOHKGXBB-DICXZTSXSA-N |
| XLogP | 5.46 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|