C24H20ClFN8O4 — CID 3096222
2-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 3096222) has the molecular formula C24H20ClFN8O4 and a molecular weight of 538.93 g/mol. Its IUPAC name is 2-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3096222 |
| Molecular Formula | C24H20ClFN8O4 |
| Molecular Weight | 538.93 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 2-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C=NNc3nc(Nc4ccc(F)cc4)nc(N4CCOCC4)n3)o2)c(Cl)c1 |
| InChI | InChI=1S/C24H20ClFN8O4/c25-20-13-17(34(35)36)5-7-19(20)21-8-6-18(38-21)14-27-32-23-29-22(28-16-3-1-15(26)2-4-16)30-24(31-23)33-9-11-37-12-10-33/h1-8,13-14H,9-12H2,(H2,28,29,30,31,32) |
| InChIKey | MBODMCXXVMONRP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|