C23H23N7 — CID 172952007
6-(azetidin-1-yl)-2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 172952007) has the molecular formula C23H23N7 and a molecular weight of 397.49 g/mol. Its IUPAC name is 6-(azetidin-1-yl)-2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(azetidin-1-yl)-2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 172952007 |
| Molecular Formula | C23H23N7 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 6-(azetidin-1-yl)-2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N/N=C/C3=CCc4ccccc43)nc(N3CCC3)n2)cc1 |
| InChI | InChI=1S/C23H23N7/c1-16-7-11-19(12-8-16)25-21-26-22(28-23(27-21)30-13-4-14-30)29-24-15-18-10-9-17-5-2-3-6-20(17)18/h2-3,5-8,10-12,15H,4,9,13-14H2,1H3,(H2,25,26,27,28,29)/b24-15+ |
| InChIKey | YWELVFRAGZROHB-BUVRLJJBSA-N |
| XLogP | 4.17 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|