C29H32ClN7 — CID 90484633
2-N-[(E)-benzylideneamino]-6-(4-benzylpiperidin-1-yl)-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 90484633) has the molecular formula C29H32ClN7 and a molecular weight of 514.08 g/mol. Its IUPAC name is 2-N-[(E)-benzylideneamino]-6-(4-benzylpiperidin-1-yl)-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[(E)-benzylideneamino]-6-(4-benzylpiperidin-1-yl)-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90484633 |
| Molecular Formula | C29H32ClN7 |
| Molecular Weight | 514.08 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 2-N-[(E)-benzylideneamino]-6-(4-benzylpiperidin-1-yl)-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(N/N=C/c3ccccc3)nc(N3CCC(Cc4ccccc4)CC3)n2)cc1.Cl |
| InChI | InChI=1S/C29H31N7.ClH/c1-22-12-14-26(15-13-22)31-27-32-28(35-30-21-25-10-6-3-7-11-25)34-29(33-27)36-18-16-24(17-19-36)20-23-8-4-2-5-9-23;/h2-15,21,24H,16-20H2,1H3,(H2,31,32,33,34,35);1H/b30-21+; |
| InChIKey | NOHNHMPZWDPPRB-IPAQGAQISA-N |
| XLogP | 6.25 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.08 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|