C36H35Cl2N7O — CID 3114165
6-(4-benzylpiperidin-1-yl)-2-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 3114165) has the molecular formula C36H35Cl2N7O and a molecular weight of 652.63 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-2-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-2-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3114165 |
| Molecular Formula | C36H35Cl2N7O |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-2-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(NN=Cc3ccc(OCc4ccc(Cl)cc4Cl)cc3)nc(N3CCC(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C36H35Cl2N7O/c1-25-7-13-31(14-8-25)40-34-41-35(43-36(42-34)45-19-17-27(18-20-45)21-26-5-3-2-4-6-26)44-39-23-28-9-15-32(16-10-28)46-24-29-11-12-30(37)22-33(29)38/h2-16,22-23,27H,17-21,24H2,1H3,(H2,40,41,42,43,44) |
| InChIKey | WPWDPCCMGGGHKV-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|