C27H23Br2Cl2N7O — CID 3500019
2-N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 3500019) has the molecular formula C27H23Br2Cl2N7O and a molecular weight of 692.24 g/mol. Its IUPAC name is 2-N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3500019 |
| Molecular Formula | C27H23Br2Cl2N7O |
| Molecular Weight | 692.24 g/mol |
| Exact Mass | 688.97 |
| IUPAC Name | 2-N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1ccc(COc2c(Br)cc(C=NNc3nc(Nc4ccccc4)nc(N4CCCC4)n3)cc2Br)c(Cl)c1 |
| InChI | InChI=1S/C27H23Br2Cl2N7O/c28-21-12-17(13-22(29)24(21)39-16-18-8-9-19(30)14-23(18)31)15-32-37-26-34-25(33-20-6-2-1-3-7-20)35-27(36-26)38-10-4-5-11-38/h1-3,6-9,12-15H,4-5,10-11,16H2,(H2,33,34,35,36,37) |
| InChIKey | FNGOGLXJWKJIET-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.24 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|