C25H27Cl2N7O3 — CID 2849185
N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 2849185) has the molecular formula C25H27Cl2N7O3 and a molecular weight of 544.44 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2849185 |
| Molecular Formula | C25H27Cl2N7O3 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1ccc(COc2ccc(C=NNc3nc(N4CCOCC4)nc(N4CCOCC4)n3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H27Cl2N7O3/c26-20-4-3-19(22(27)15-20)17-37-21-5-1-18(2-6-21)16-28-32-23-29-24(33-7-11-35-12-8-33)31-25(30-23)34-9-13-36-14-10-34/h1-6,15-16H,7-14,17H2,(H,29,30,31,32) |
| InChIKey | ZRFLVWAUHMLWMM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|