C29H29Cl2N7O3 — CID 143764661
2-[(2,4-dichlorophenyl)methoxy]-5-[(E)-[[4-(2,4-dimethylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 143764661) has the molecular formula C29H29Cl2N7O3 and a molecular weight of 594.50 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-5-[(E)-[[4-(2,4-dimethylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-5-[(E)-[[4-(2,4-dimethylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 143764661 |
| Molecular Formula | C29H29Cl2N7O3 |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-5-[(E)-[[4-(2,4-dimethylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Cc1ccc(Nc2nc(N/N=C/c3ccc(OCc4ccc(Cl)cc4Cl)c(O)c3)nc(N3CCOCC3)n2)c(C)c1 |
| InChI | InChI=1S/C29H29Cl2N7O3/c1-18-3-7-24(19(2)13-18)33-27-34-28(36-29(35-27)38-9-11-40-12-10-38)37-32-16-20-4-8-26(25(39)14-20)41-17-21-5-6-22(30)15-23(21)31/h3-8,13-16,39H,9-12,17H2,1-2H3,(H2,33,34,35,36,37)/b32-16+ |
| InChIKey | PHGVVBPBHCBURB-KPGMTVGESA-N |
| XLogP | 6.11 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|