C21H20Br3N7O2 — CID 135536606
2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 135536606) has the molecular formula C21H20Br3N7O2 and a molecular weight of 642.15 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135536606 |
| Molecular Formula | C21H20Br3N7O2 |
| Molecular Weight | 642.15 g/mol |
| Exact Mass | 638.92 |
| IUPAC Name | 2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Cc1ccc(Nc2nc(N/N=C/c3cc(Br)cc(Br)c3O)nc(N3CCOCC3)n2)c(Br)c1 |
| InChI | InChI=1S/C21H20Br3N7O2/c1-12-2-3-17(15(23)8-12)26-19-27-20(29-21(28-19)31-4-6-33-7-5-31)30-25-11-13-9-14(22)10-16(24)18(13)32/h2-3,8-11,32H,4-7H2,1H3,(H2,26,27,28,29,30)/b25-11+ |
| InChIKey | GIJBVFWIPFLVIG-OPEKNORGSA-N |
| XLogP | 5.20 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.15 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|