C22H22Br2ClN7O3 — CID 137089064
4-bromo-2-[(Z)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenol (PubChem CID 137089064) has the molecular formula C22H22Br2ClN7O3 and a molecular weight of 627.73 g/mol. Its IUPAC name is 4-bromo-2-[(Z)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenol.
| Compound Name | 4-bromo-2-[(Z)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 137089064 |
| Molecular Formula | C22H22Br2ClN7O3 |
| Molecular Weight | 627.73 g/mol |
| Exact Mass | 624.98 |
| IUPAC Name | 4-bromo-2-[(Z)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-methoxyphenol |
| SMILES | COc1cc(Br)cc(/C=N\Nc2nc(Nc3cc(Cl)c(C)cc3Br)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C22H22Br2ClN7O3/c1-12-7-15(24)17(10-16(12)25)27-20-28-21(30-22(29-20)32-3-5-35-6-4-32)31-26-11-13-8-14(23)9-18(34-2)19(13)33/h7-11,33H,3-6H2,1-2H3,(H2,27,28,29,30,31)/b26-11- |
| InChIKey | SKFBMNURPQWPAE-RAWMCFOBSA-N |
| XLogP | 5.10 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.73 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|