C21H19BrClN9O6 — CID 135683970
2-[(E)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol (PubChem CID 135683970) has the molecular formula C21H19BrClN9O6 and a molecular weight of 608.80 g/mol. Its IUPAC name is 2-[(E)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol.
| Compound Name | 2-[(E)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 135683970 |
| Molecular Formula | C21H19BrClN9O6 |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 607.03 |
| IUPAC Name | 2-[(E)-[[4-(2-bromo-5-chloro-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
| SMILES | Cc1cc(Br)c(Nc2nc(N/N=C/c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3O)nc(N3CCOCC3)n2)cc1Cl |
| InChI | InChI=1S/C21H19BrClN9O6/c1-11-6-14(22)16(9-15(11)23)25-19-26-20(28-21(27-19)30-2-4-38-5-3-30)29-24-10-12-7-13(31(34)35)8-17(18(12)33)32(36)37/h6-10,33H,2-5H2,1H3,(H2,25,26,27,28,29)/b24-10+ |
| InChIKey | WKRSSXFHDZOGEQ-YSURURNPSA-N |
| XLogP | 4.14 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|