C15H16N8O7 — CID 135936333
2-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-dinitrophenol (PubChem CID 135936333) has the molecular formula C15H16N8O7 and a molecular weight of 420.34 g/mol. Its IUPAC name is 2-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-dinitrophenol.
| Compound Name | 2-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 135936333 |
| Molecular Formula | C15H16N8O7 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4,6-dinitrophenol |
| SMILES | COc1nc(N/N=C\c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H16N8O7/c1-29-15-18-13(17-14(19-15)21-2-4-30-5-3-21)20-16-8-9-6-10(22(25)26)7-11(12(9)24)23(27)28/h6-8,24H,2-5H2,1H3,(H,17,18,19,20)/b16-8- |
| InChIKey | SVHMJDBXCGCWTJ-PXNMLYILSA-N |
| XLogP | 0.68 |
| TPSA | 191.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|