C15H18N6O3 — CID 3106803
4-[[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 3106803) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-[[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3106803 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-[[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1nc(NN=Cc2ccc(O)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H18N6O3/c1-23-15-18-13(17-14(19-15)21-6-8-24-9-7-21)20-16-10-11-2-4-12(22)5-3-11/h2-5,10,22H,6-9H2,1H3,(H,17,18,19,20) |
| InChIKey | YBMHMIBXQLXYBS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|