C21H23ClFN7O2 — CID 91962052
4-N-(4-fluorophenyl)-2-N-[(4-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 91962052) has the molecular formula C21H23ClFN7O2 and a molecular weight of 459.91 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-2-N-[(4-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 4-N-(4-fluorophenyl)-2-N-[(4-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 91962052 |
| Molecular Formula | C21H23ClFN7O2 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 4-N-(4-fluorophenyl)-2-N-[(4-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | COc1ccc(C=NNc2nc(Nc3ccc(F)cc3)nc(N3CCOCC3)n2)cc1.Cl |
| InChI | InChI=1S/C21H22FN7O2.ClH/c1-30-18-8-2-15(3-9-18)14-23-28-20-25-19(24-17-6-4-16(22)5-7-17)26-21(27-20)29-10-12-31-13-11-29;/h2-9,14H,10-13H2,1H3,(H2,24,25,26,27,28);1H |
| InChIKey | HMLKGJZAADRAHX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|