C21H20ClF4N7O — CID 163330789
4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 163330789) has the molecular formula C21H20ClF4N7O and a molecular weight of 497.88 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 163330789 |
| Molecular Formula | C21H20ClF4N7O |
| Molecular Weight | 497.88 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cl.Fc1ccc(Nc2nc(N/N=C\c3ccccc3C(F)(F)F)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H19F4N7O.ClH/c22-15-5-7-16(8-6-15)27-18-28-19(30-20(29-18)32-9-11-33-12-10-32)31-26-13-14-3-1-2-4-17(14)21(23,24)25;/h1-8,13H,9-12H2,(H2,27,28,29,30,31);1H/b26-13-; |
| InChIKey | TZNCBSOAPAPPAO-BQHDHOAWSA-N |
| XLogP | 4.48 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|