C22H22Cl2F3N7O — CID 91962080
4-N-(3-chloro-4-methylphenyl)-6-morpholin-4-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 91962080) has the molecular formula C22H22Cl2F3N7O and a molecular weight of 528.37 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methylphenyl)-6-morpholin-4-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 4-N-(3-chloro-4-methylphenyl)-6-morpholin-4-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 91962080 |
| Molecular Formula | C22H22Cl2F3N7O |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 4-N-(3-chloro-4-methylphenyl)-6-morpholin-4-yl-2-N-[[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(NN=Cc3ccccc3C(F)(F)F)nc(N3CCOCC3)n2)cc1Cl.Cl |
| InChI | InChI=1S/C22H21ClF3N7O.ClH/c1-14-6-7-16(12-18(14)23)28-19-29-20(31-21(30-19)33-8-10-34-11-9-33)32-27-13-15-4-2-3-5-17(15)22(24,25)26;/h2-7,12-13H,8-11H2,1H3,(H2,28,29,30,31,32);1H |
| InChIKey | KSZLHDLGASZBPO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|