C23H22FN9O — CID 2859315
4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 2859315) has the molecular formula C23H22FN9O and a molecular weight of 459.49 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2859315 |
| Molecular Formula | C23H22FN9O |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 4-N-(4-fluorophenyl)-6-morpholin-4-yl-2-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1ccc(Nc2nc(NN=Cc3cn[nH]c3-c3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C23H22FN9O/c24-18-6-8-19(9-7-18)27-21-28-22(30-23(29-21)33-10-12-34-13-11-33)32-26-15-17-14-25-31-20(17)16-4-2-1-3-5-16/h1-9,14-15H,10-13H2,(H,25,31)(H2,27,28,29,30,32) |
| InChIKey | HOKWWBOEEHCTHP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|