C16H19BrN6O4 — CID 136914683
4-bromo-2-methoxy-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 136914683) has the molecular formula C16H19BrN6O4 and a molecular weight of 439.27 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-methoxy-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136914683 |
| Molecular Formula | C16H19BrN6O4 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-bromo-2-methoxy-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1nc(N/N=C\c2cc(Br)cc(OC)c2O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H19BrN6O4/c1-25-12-8-11(17)7-10(13(12)24)9-18-22-14-19-15(21-16(20-14)26-2)23-3-5-27-6-4-23/h7-9,24H,3-6H2,1-2H3,(H,19,20,21,22)/b18-9- |
| InChIKey | MSDORFQZENGUTO-NVMNQCDNSA-N |
| XLogP | 1.64 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|