C15H16BrN7O5 — CID 135906562
2-bromo-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol (PubChem CID 135906562) has the molecular formula C15H16BrN7O5 and a molecular weight of 454.24 g/mol. Its IUPAC name is 2-bromo-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol.
| Compound Name | 2-bromo-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 135906562 |
| Molecular Formula | C15H16BrN7O5 |
| Molecular Weight | 454.24 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-bromo-6-[(Z)-[(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol |
| SMILES | COc1nc(N/N=C\c2cc([N+](=O)[O-])cc(Br)c2O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H16BrN7O5/c1-27-15-19-13(18-14(20-15)22-2-4-28-5-3-22)21-17-8-9-6-10(23(25)26)7-11(16)12(9)24/h6-8,24H,2-5H2,1H3,(H,18,19,20,21)/b17-8- |
| InChIKey | UXRUUNPHQZSJGX-IUXPMGMMSA-N |
| XLogP | 1.54 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|