C20H19BrN8O4 — CID 135416266
2-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol (PubChem CID 135416266) has the molecular formula C20H19BrN8O4 and a molecular weight of 515.33 g/mol. Its IUPAC name is 2-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol.
| Compound Name | 2-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol |
|---|---|
| PubChem CID | 135416266 |
| Molecular Formula | C20H19BrN8O4 |
| Molecular Weight | 515.33 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 2-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c(/C=N/Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C20H19BrN8O4/c21-16-11-15(29(31)32)10-13(17(16)30)12-22-27-19-24-18(23-14-4-2-1-3-5-14)25-20(26-19)28-6-8-33-9-7-28/h1-5,10-12,30H,6-9H2,(H2,23,24,25,26,27)/b22-12+ |
| InChIKey | YCPSNYLKJNKHKU-WSDLNYQXSA-N |
| XLogP | 3.27 |
| TPSA | 150.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|