C19H24N8O6 — CID 135536617
4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenol (PubChem CID 135536617) has the molecular formula C19H24N8O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is 4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 135536617 |
| Molecular Formula | C19H24N8O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1cc(/C=N/Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H24N8O6/c1-31-15-11-13(10-14(16(15)28)27(29)30)12-20-24-17-21-18(25-2-6-32-7-3-25)23-19(22-17)26-4-8-33-9-5-26/h10-12,28H,2-9H2,1H3,(H,21,22,23,24)/b20-12+ |
| InChIKey | CNRWNQOVMIYVRG-UDWIEESQSA-N |
| XLogP | 0.61 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|