C19H23Br2N7O3 — CID 135613536
2,3-dibromo-6-methoxy-4-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 135613536) has the molecular formula C19H23Br2N7O3 and a molecular weight of 557.25 g/mol. Its IUPAC name is 2,3-dibromo-6-methoxy-4-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,3-dibromo-6-methoxy-4-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135613536 |
| Molecular Formula | C19H23Br2N7O3 |
| Molecular Weight | 557.25 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | 2,3-dibromo-6-methoxy-4-[(E)-[(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N/Nc2nc(N3CCCC3)nc(N3CCOCC3)n2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C19H23Br2N7O3/c1-30-13-10-12(14(20)15(21)16(13)29)11-22-26-17-23-18(27-4-2-3-5-27)25-19(24-17)28-6-8-31-9-7-28/h10-11,29H,2-9H2,1H3,(H,23,24,25,26)/b22-11+ |
| InChIKey | RPYFCWKNMFUBKP-SSDVNMTOSA-N |
| XLogP | 2.99 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|