C30H40N12O4 — CID 5227632
N-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 5227632) has the molecular formula C30H40N12O4 and a molecular weight of 632.73 g/mol. Its IUPAC name is N-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 5227632 |
| Molecular Formula | C30H40N12O4 |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | N-[[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | COc1cc(C=NNc2nc(N3CCCC3)nc(N3CCCC3)n2)ccc1Oc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C30H40N12O4/c1-43-24-20-22(21-31-38-25-32-26(39-8-2-3-9-39)34-27(33-25)40-10-4-5-11-40)6-7-23(24)46-30-36-28(41-12-16-44-17-13-41)35-29(37-30)42-14-18-45-19-15-42/h6-7,20-21H,2-5,8-19H2,1H3,(H,32,33,34,38) |
| InChIKey | NGMSADWUBFHKRZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|