C24H27N7O6 — CID 5340684
[4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 5340684) has the molecular formula C24H27N7O6 and a molecular weight of 509.52 g/mol. Its IUPAC name is [4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 5340684 |
| Molecular Formula | C24H27N7O6 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=N/Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C24H27N7O6/c1-33-20-15-17(4-5-18(20)37-21(32)19-3-2-10-36-19)16-25-29-22-26-23(30-6-11-34-12-7-30)28-24(27-22)31-8-13-35-14-9-31/h2-5,10,15-16H,6-9,11-14H2,1H3,(H,26,27,28,29)/b25-16+ |
| InChIKey | SCMLBZLPRUUIEV-PCLIKHOPSA-N |
| XLogP | 1.81 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|