C28H27N7O5 — CID 10196392
[4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-propanoylphenyl] furan-2-carboxylate (PubChem CID 10196392) has the molecular formula C28H27N7O5 and a molecular weight of 541.57 g/mol. Its IUPAC name is [4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-propanoylphenyl] furan-2-carboxylate.
| Compound Name | [4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-propanoylphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 10196392 |
| Molecular Formula | C28H27N7O5 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | [4-[(E)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-propanoylphenyl] furan-2-carboxylate |
| SMILES | CCC(=O)c1cc(/C=N/Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C28H27N7O5/c1-2-22(36)21-17-19(10-11-23(21)40-25(37)24-9-6-14-39-24)18-29-34-27-31-26(30-20-7-4-3-5-8-20)32-28(33-27)35-12-15-38-16-13-35/h3-11,14,17-18H,2,12-13,15-16H2,1H3,(H2,30,31,32,33,34)/b29-18+ |
| InChIKey | TYESASOKOBRWEC-RDRPBHBLSA-N |
| XLogP | 4.30 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|