C23H30N8O2 — CID 4597499
2-[4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 4597499) has the molecular formula C23H30N8O2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 4597499 |
| Molecular Formula | C23H30N8O2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2-[4-[[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(C=NNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)ccc1OCC#N |
| InChI | InChI=1S/C23H30N8O2/c1-32-20-16-18(8-9-19(20)33-15-10-24)17-25-29-21-26-22(30-11-4-2-5-12-30)28-23(27-21)31-13-6-3-7-14-31/h8-9,16-17H,2-7,11-15H2,1H3,(H,26,27,28,29) |
| InChIKey | DVZIGJICQAXQDZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|